CAS 94123-05-4

2-(B-D-galactosidoxy)-naphthol as-lc

Description:

2-(B-D-galactosidoxy)-naphthol as-lc, with the CAS number 94123-05-4, is a chemical compound that features a naphthol moiety linked to a galactoside. This structure suggests that it possesses both aromatic and carbohydrate characteristics, which can influence its solubility, reactivity, and biological activity. The presence of the galactosidoxy group indicates that it may participate in glycosidic bond formation and could be involved in various biochemical processes, such as enzyme-substrate interactions. The naphthol component may contribute to its potential as a chromophore, allowing for applications in colorimetric assays or as a fluorescent marker. Additionally, compounds like this can exhibit specific binding properties, making them useful in biochemical research, particularly in studies involving carbohydrate recognition or enzyme activity. Overall, the unique combination of functional groups in 2-(B-D-galactosidoxy)-naphthol as-lc suggests a versatile compound with potential applications in both analytical chemistry and biochemistry.

Formula: C₂₅H₂₆ClNO₉

InChI: InChI=1/C25H26ClNO9/c1-33-18-10-16(19(34-2)9-15(18)26)27-24(32)14-7-12-5-3-4-6-13(12)8-17(14)35-25-23(31)22(30)21(29)20(11-28)36-25/h3-10,20-23,25,28-31H,11H2,1-2H3,(H,27,32)

SMILES: COc1cc(c(cc1Cl)OC)N=C(c1cc2ccccc2cc1OC1C(C(C(C(CO)O1)O)O)O)O

Synonyms:

• N-(4-chloro-2,5-dimethoxyphenyl)-3-(hexopyranosyloxy)naphthalene-2-carboxamide

2-(β-D-Galactosidoxy)naphthol AS-LC

CAS: 94123-05-4

Formula: C₂₅H₂₆ClNO₉

Molecular weight: 519.93

Ref: 7W-GT6281