CAS 94125-42-5

2-(3,3,3-Trifluoropropyl)benzenesulfonamide

Description:

2-(3,3,3-Trifluoropropyl)benzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring, along with a trifluoropropyl substituent. This compound features a sulfonamide group (-SO2NH2), which is known for its role in pharmaceuticals and agrochemicals due to its ability to form hydrogen bonds and interact with biological targets. The trifluoropropyl group introduces significant electronegativity and lipophilicity, which can enhance the compound's biological activity and solubility properties. The presence of fluorine atoms often contributes to increased metabolic stability and altered pharmacokinetics. This compound may exhibit properties such as moderate to high melting and boiling points, depending on its molecular interactions. Additionally, it may be used in various applications, including medicinal chemistry, where it could serve as a scaffold for drug development or as a reagent in synthetic organic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.

Formula: C₉H₁₀F₃NO₂S

InChI: InChI=1S/C9H10F3NO2S/c10-9(11,12)6-5-7-3-1-2-4-8(7)16(13,14)15/h1-4H,5-6H2,(H2,13,14,15)

InChI key: InChIKey=PIJUMEVHGDAQBH-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(CCC(F)(F)F)C=CC=C1

Synonyms:

• 2-(3,3,3-Trifluoropropyl)benzene-1-sulfonamide
• 2-(3,3,3-Trifluoropropyl)benzenesulfonamide
• Benzenesulfonamide, 2-(3,3,3-trifluoropropyl)-