CAS 941294-25-3

1,3-Dichloro-7-fluoroisoquinoline

Description:

1,3-Dichloro-7-fluoroisoquinoline is a heterocyclic organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of two chlorine atoms at the 1 and 3 positions and a fluorine atom at the 7 position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential reactivity due to the electronegative halogen substituents, which can influence its behavior in chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Additionally, the presence of halogens may impart biological activity, making it of interest in pharmaceutical research. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 1,3-Dichloro-7-fluoroisoquinoline is a compound of interest in both synthetic chemistry and medicinal chemistry due to its structural features and potential applications.

Formula: C₉H₄Cl₂FN

InChI: InChI=1S/C9H4Cl2FN/c10-8-3-5-1-2-6(12)4-7(5)9(11)13-8/h1-4H

InChI key: InChIKey=RPCBWABYLPCEQX-UHFFFAOYSA-N

SMILES: ClC=1C2=C(C=C(Cl)N1)C=CC(F)=C2

Synonyms:

• 1,3-Dichloro-6-fluoroisoquinoline
• Isoquinoline, 1,3-dichloro-7-fluoro-
• 1,3-Dichloro-7-fluoroisoquinoline

1,3-Dichloro-7-fluoroisoquinoline

CAS: 941294-25-3

Formula: C₉H₄Cl₂FN

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.0392

Ref: IN-DA003DJE

1,3-Dichloro-7-fluoroisoquinoline

CAS: 941294-25-3

1,3-Dichloro-7-fluoroisoquinoline

Purity: 95%

Molecular weight: 216.04g/mol

Ref: 54-PC7422

1,3-Dichloro-7-fluoroisoquinoline

CAS: 941294-25-3

Formula: C₉H₄Cl₂FN

Purity: 97%

Color and Shape: Solid

Molecular weight: 216.04

Ref: 10-F210958