CAS 941294-49-1
:6-Chloro-N-(3-methoxypropyl)-2-pyrazinamine
Description:
6-Chloro-N-(3-methoxypropyl)-2-pyrazinamine is a chemical compound characterized by its pyrazinamine core, which features a chlorine substituent at the 6-position and a methoxypropyl group at the nitrogen atom. This compound belongs to the class of heterocyclic amines, which are known for their diverse biological activities. The presence of the chlorine atom can influence the compound's reactivity and solubility, while the methoxypropyl group may enhance its lipophilicity, potentially affecting its pharmacokinetic properties. The pyrazine ring contributes to the compound's aromaticity and stability. Such compounds are often investigated for their potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. The specific interactions of this compound with biological systems would depend on its structural features, including the orientation of substituents and the overall three-dimensional conformation. As with many chemical substances, safety data and handling precautions should be considered, especially in laboratory settings.
Formula:C8H12ClN3O
InChI:InChI=1S/C8H12ClN3O/c1-13-4-2-3-11-8-6-10-5-7(9)12-8/h5-6H,2-4H2,1H3,(H,11,12)
InChI key:InChIKey=PBVVSSOMJSQOOJ-UHFFFAOYSA-N
SMILES:N(CCCOC)C1=NC(Cl)=CN=C1
Synonyms:- (6-Chloro-pyrazin-2-yl)-(3-methoxy-propyl)-amine
- (6-Chloro-pyridazin-3-yl)-(3-methoxy-propyl)-amine
- (6-Chloropyrazin-2-yl)(3-methoxypropyl)amine
- 2-Chloro-6-isopropylaminopyrazine
- 2-Pyrazinamine, 6-chloro-N-(3-methoxypropyl)-
- 6-Chloro-N-(3-methoxypropyl)-2-pyrazinamine
- 6-Chloro-N-(3-methoxypropyl)pyrazin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
