CAS 941294-50-4

Ethyl 2-[[(1,1-dimethylethoxy)carbonyl]amino]-5-oxazolecarboxylate

Description:

Ethyl 2-[[(1,1-dimethylethoxy)carbonyl]amino]-5-oxazolecarboxylate, with the CAS number 941294-50-4, is a chemical compound characterized by its complex structure that includes an oxazole ring, an ethyl ester group, and a dimethylethoxy carbonyl moiety. This compound typically exhibits properties associated with both its functional groups and heterocyclic nature, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino and carboxylate functionalities. The oxazole ring contributes to its stability and may influence its biological activity, making it of interest in pharmaceutical research. Additionally, the presence of the ethyl ester suggests that it may undergo hydrolysis under certain conditions, releasing the corresponding acid. Overall, this compound's unique structure and functional groups may provide avenues for further exploration in synthetic chemistry and medicinal applications.

Formula: C₁₁H₁₆N₂O₅

InChI: InChI=1S/C11H16N2O5/c1-5-16-8(14)7-6-12-9(17-7)13-10(15)18-11(2,3)4/h6H,5H2,1-4H3,(H,12,13,15)

InChI key: InChIKey=KKWALHUVCIYBSO-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1OC(NC(OC(C)(C)C)=O)=NC1

Synonyms:

• Ethyl 2-[[(1,1-dimethylethoxy)carbonyl]amino]-5-oxazolecarboxylate
• 5-Oxazolecarboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, ethyl ester

Ethyl 2-(t-butoxycarbonylamino)oxazole-5-carboxylate

CAS: 941294-50-4

Formula: C₁₁H₁₆N₂O₅

Molecular weight: 256.2551

Ref: IN-DA0067EM

Ethyl 2-amino-1,3-oxazole-5-carboxylate, N-BOC protected

CAS: 941294-50-4

Ethyl 2-amino-1,3-oxazole-5-carboxylate, N-BOC protected

Purity: 98%

Molecular weight: 256.26g/mol

Ref: 54-OR11529