CAS 941294-53-7

N-[2-Bromo-4-(trifluoromethoxy)phenyl]formamide

Description:

N-[2-Bromo-4-(trifluoromethoxy)phenyl]formamide is a chemical compound characterized by its unique functional groups and structural features. It contains a formamide moiety, which is indicative of its potential reactivity and applications in organic synthesis. The presence of a bromine atom and a trifluoromethoxy group on the phenyl ring contributes to its distinctive electronic properties, enhancing its reactivity and solubility in various solvents. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms, which can influence its interactions with other molecules. Additionally, the bromine substituent may provide opportunities for further chemical modifications, making it a valuable intermediate in pharmaceutical and agrochemical research. Its CAS number, 941294-53-7, allows for easy identification and reference in chemical databases. Overall, N-[2-Bromo-4-(trifluoromethoxy)phenyl]formamide is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₈H₅BrF₃NO₂

InChI: InChI=1S/C8H5BrF3NO2/c9-6-3-5(15-8(10,11)12)1-2-7(6)13-4-14/h1-4H,(H,13,14)

InChI key: InChIKey=SPMBDIDHPBXCCV-UHFFFAOYSA-N

SMILES: N(C=O)C1=C(Br)C=C(OC(F)(F)F)C=C1

Synonyms:

• Formamide, N-[2-bromo-4-(trifluoromethoxy)phenyl]-
• N-[2-Bromo-4-(trifluoromethoxy)phenyl]formamide
• N-Formyl2-bromo-4-(trifluoromethoxy)aniline98%
• (4-formylamino-3-bromophenyl) trifluoromethyl ether

N-Formyl 2-bromo-4-trifluoromethoxyaniline

CAS: 941294-53-7

Formula: C₈H₅BrF₃NO₂

Molecular weight: 284.0300

Ref: IN-DA003T18

N-Formyl 2-bromo-4-(trifluoromethoxy)aniline

CAS: 941294-53-7

N-Formyl 2-bromo-4-(trifluoromethoxy)aniline

Purity: 98%

Molecular weight: 284.03g/mol

Ref: 54-PC7704