CAS 94130-58-2
:2-(3,4-dihydroxyphenyl)ethyl 6-deoxy-alpha-L-mannopyranosyl-(1->3)-[beta-D-xylopyranosyl-(1->6)]-4-O-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-beta-D-glucopyranoside
Description:
The chemical substance known as "2-(3,4-dihydroxyphenyl)ethyl 6-deoxy-alpha-L-mannopyranosyl-(1->3)-[beta-D-xylopyranosyl-(1->6)]-4-O-[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-beta-D-glucopyranoside," with the CAS number 94130-58-2, is a complex glycoside. This compound features multiple sugar moieties, including a glucopyranoside and a xylopyranoside, which contribute to its structural complexity and potential biological activity. The presence of 3,4-dihydroxyphenyl groups suggests antioxidant properties, while the glycosidic linkages indicate that it may have implications in carbohydrate metabolism or interactions with biological receptors. The compound's structure suggests it may be soluble in polar solvents, and its stability could be influenced by pH and temperature. Such compounds are often studied for their potential health benefits, including anti-inflammatory and anti-cancer properties, due to the presence of phenolic groups. Further research would be necessary to elucidate its specific biological activities and potential applications in pharmaceuticals or nutraceuticals.
Formula:C34H44O19
InChI:InChI=1/C34H44O19/c1-14-24(41)26(43)28(45)34(50-14)53-31-29(46)33(47-9-8-16-3-6-18(36)20(38)11-16)51-22(13-49-32-27(44)25(42)21(39)12-48-32)30(31)52-23(40)7-4-15-2-5-17(35)19(37)10-15/h2-7,10-11,14,21-22,24-39,41-46H,8-9,12-13H2,1H3/b7-4+/t14-,21+,22+,24-,25-,26+,27+,28+,29+,30+,31+,32-,33+,34-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Forsythoside F
CAS:Forsythoside F (Arenarioside) is a natural product, and GI50 values of 10-16 microM against B16F10 cell.Formula:C34H44O19Purity:99.69% - 99.84%Color and Shape:SolidMolecular weight:756.7Forsythoside F
CAS:<p>Forsythoside F is a natural phenylethanoid glycoside, which is primarily derived from various plant species such as Forsythia suspensa. This compound is a secondary metabolite formed through plant biosynthetic pathways. Its mode of action involves the inhibition of free radical formation, modulation of inflammatory pathways, and the protection of cellular components from oxidative damage.</p>Formula:C34H44O19Purity:Min. 95%Color and Shape:SolidMolecular weight:756.7 g/mol


