
CAS 94133-60-5
:2-Ethyl 3-carboxy-1-methyl-1H-pyrrole-2-acetate
Description:
2-Ethyl 3-carboxy-1-methyl-1H-pyrrole-2-acetate is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an ethyl group and a carboxylic acid moiety, contributing to its solubility and reactivity. The presence of the acetate group indicates that it can participate in esterification reactions. Its molecular structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The compound may exhibit specific biological activities due to the pyrrole framework, which is known for its presence in various natural products and bioactive compounds. Additionally, the presence of functional groups such as the carboxylic acid and ester can influence its acidity, polarity, and overall reactivity. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through further research and safety data sheets.
Formula:C10H13NO4
InChI:InChI=1S/C10H13NO4/c1-3-15-9(12)6-8-7(10(13)14)4-5-11(8)2/h4-5H,3,6H2,1-2H3,(H,13,14)
InChI key:InChIKey=FPXZSYDPROCSEG-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C1=C(C(O)=O)C=CN1C
Synonyms:- 1H-Pyrrole-2-acetic acid, 3-carboxy-1-methyl-, 2-ethyl ester
- 2-Ethyl 3-carboxy-1-methyl-1H-pyrrole-2-acetate
- 1H-Pyrrole-2-acetic acid, 3-carboxy-1-methyl-, α-ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.