
CAS 94133-61-6
:Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate
Description:
Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate is a chemical compound characterized by its unique structure, which includes a dioxolane ring, an acetate group, and a bromomethyl substituent. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents such as ethanol and dichloromethane. It is often used in organic synthesis, particularly in the preparation of more complex molecules due to its reactivity, especially the bromomethyl group, which can participate in nucleophilic substitution reactions. The presence of the dioxolane ring contributes to its stability and can influence its reactivity in various chemical reactions. Additionally, the acetate moiety can serve as a leaving group, facilitating further transformations. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and eyes, and potential toxicity if ingested or inhaled. Proper storage in a cool, dry place away from incompatible materials is recommended to maintain its integrity.
Formula:C8H13BrO4
InChI:InChI=1S/C8H13BrO4/c1-2-11-7(10)5-8(6-9)12-3-4-13-8/h2-6H2,1H3
InChI key:InChIKey=WDFFBKCRZJATND-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C1(CBr)OCCO1
Synonyms:- Ethyl 2-(bromomethyl)-1,3-dioxolane-2-acetate
- 1,3-Dioxolane-2-acetic acid, 2-(bromomethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.