CAS 94133-97-8
:3,8,11,14-Tetraoxaoctadecan-18-ol, 2-oxo-, acetate
Description:
3,8,11,14-Tetraoxaoctadecan-18-ol, 2-oxo-, acetate, with the CAS number 94133-97-8, is a synthetic chemical compound characterized by its complex structure that includes multiple ether linkages and an acetate functional group. This compound features a long carbon chain, which contributes to its hydrophobic properties, while the presence of oxygen atoms in the form of ether groups enhances its solubility in polar solvents. The acetate group indicates that it can undergo hydrolysis, potentially releasing acetic acid under certain conditions. This compound may exhibit interesting biological activities due to its structural features, making it of interest in various fields, including medicinal chemistry and materials science. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact. Overall, 3,8,11,14-Tetraoxaoctadecan-18-ol, 2-oxo-, acetate represents a unique class of chemical substances with potential applications in diverse areas.
Formula:C16H30O7
InChI:InChI=1S/C16H30O7/c1-15(17)22-9-5-3-7-19-11-13-21-14-12-20-8-4-6-10-23-16(2)18/h3-14H2,1-2H3
InChI key:InChIKey=ATHFLNGYVMMERW-UHFFFAOYSA-N
SMILES:C(OC(C)=O)CCCOCCOCCOCCCCOC(C)=O
Synonyms:- 3,8,11,14-Tetraoxaoctadecan-18-ol, 2-oxo-, acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
