CAS 94134-54-0

(5-Chloro-2-hydroxy-4-methylphenyl)(4-chlorophenyl)methanone

Description:

(5-Chloro-2-hydroxy-4-methylphenyl)(4-chlorophenyl)methanone, with the CAS number 94134-54-0, is an organic compound characterized by its complex structure, which includes a phenyl ring substituted with both chlorine and hydroxyl groups, as well as a ketone functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for electrophilic substitution reactions. The presence of chlorine atoms enhances its reactivity and may influence its solubility in various solvents. The hydroxyl group contributes to its potential as a hydrogen bond donor, which can affect its interactions in biological systems or with other chemical species. Additionally, the methyl group on the phenyl ring can influence the compound's steric properties and overall reactivity. This compound may be of interest in pharmaceutical research or as an intermediate in organic synthesis due to its unique functional groups and structural characteristics. Safety data and handling precautions should be consulted, as halogenated compounds can pose environmental and health risks.

Formula: C₁₄H₁₀Cl₂O₂

InChI: InChI=1S/C14H10Cl2O2/c1-8-6-13(17)11(7-12(8)16)14(18)9-2-4-10(15)5-3-9/h2-7,17H,1H3

InChI key: InChIKey=QLDYVILRXZAYKD-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(O)C=C(C)C(Cl)=C1)C2=CC=C(Cl)C=C2

Synonyms:

• (5-Chloro-2-hydroxy-4-methylphenyl)(4-chlorophenyl)methanone
• Methanone, (5-chloro-2-hydroxy-4-methylphenyl)(4-chlorophenyl)-