CAS 94134-86-8
:5-Butyl-2-methylphenol
Description:
5-Butyl-2-methylphenol, with the CAS number 94134-86-8, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This compound features a butyl group and a methyl group as substituents on the aromatic ring, specifically at the 5 and 2 positions, respectively. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the hydroxyl group imparts certain polar characteristics, making it soluble in alcohols and other polar solvents while being less soluble in non-polar solvents. 5-Butyl-2-methylphenol exhibits antioxidant properties, which can be beneficial in various applications, including as a stabilizer in plastics and as a potential additive in food and cosmetics. Its chemical stability and reactivity can be influenced by the substituents on the aromatic ring, affecting its behavior in different chemical environments. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C11H16O
InChI:InChI=1S/C11H16O/c1-3-4-5-10-7-6-9(2)11(12)8-10/h6-8,12H,3-5H2,1-2H3
InChI key:InChIKey=CUYLNCWYFSSEQG-UHFFFAOYSA-N
SMILES:C(CCC)C1=CC(O)=C(C)C=C1
Synonyms:- NSC 309967
- Phenol, 5-butyl-2-methyl-
- 5-Butyl-2-methylphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
