CAS 94134-94-8
:5-Methyl-3-pyrrolidinol
Description:
5-Methyl-3-pyrrolidinol is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features a hydroxyl group (-OH) and a methyl group (-CH3) attached to the pyrrolidine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the hydroxyl group makes it a secondary amine, which can participate in hydrogen bonding, influencing its solubility in polar solvents like water and alcohols. 5-Methyl-3-pyrrolidinol is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity can be attributed to the functional groups present, allowing it to undergo various chemical reactions, including oxidation and acylation. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C5H11NO
InChI:InChI=1S/C5H11NO/c1-4-2-5(7)3-6-4/h4-7H,2-3H2,1H3
InChI key:InChIKey=AGTDSFXRPBMMGQ-UHFFFAOYSA-N
SMILES:OC1CC(C)NC1
Synonyms:- 3-Hydroxy-5-methylpyrrolidine
- 310-142-8
- 5-Methyl-3-pyrrolidinol
- 5-Methylpyrrolidin-3-Ol
- 3-Pyrrolidinol, 5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Methylpyrrolidin-3-ol
CAS:Controlled Product<p>Applications 5-METHYLPYRROLIDIN-3-OL (cas# 94134-94-8) is a useful research chemical.<br></p>Formula:C5H11NOColor and Shape:NeatMolecular weight:101.15
