CymitQuimica logo

CAS 94135-63-4

:

Hexanedioic acid, compd. with N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]-1,2-ethanediamine (1:?)

Description:
Hexanedioic acid, also known as adipic acid, is a dicarboxylic acid characterized by its six-carbon chain with carboxylic acid functional groups at each end. The compound in question, which is a complex formed with N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]-1,2-ethanediamine, suggests a structure that includes multiple amine groups, indicating potential for strong hydrogen bonding and increased solubility in polar solvents. This complex likely exhibits properties typical of both the hexanedioic acid and the amine component, such as being hygroscopic and having a relatively high melting point. The presence of multiple amine groups may enhance its reactivity and ability to form coordination complexes with metal ions. Additionally, the compound may have applications in various fields, including pharmaceuticals and materials science, due to its potential as a building block for more complex molecules or as a chelating agent. Overall, the combination of these functional groups suggests a versatile compound with interesting chemical behavior.
Formula:C8H23N5·xC6H10O4
InChI:InChI=1S/C8H23N5.C6H10O4/c9-1-3-11-5-7-13-8-6-12-4-2-10;7-5(8)3-1-2-4-6(9)10/h11-13H,1-10H2;1-4H2,(H,7,8)(H,9,10)
InChI key:InChIKey=ADLPVBCBMDDLJK-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)CC(O)=O.N(CCNCCN)CCNCCN
Synonyms:
  • Hexanedioic acid, compd. with N1-(2-aminoethyl)-N2-[2-[(2-aminoethyl)amino]ethyl]-1,2-ethanediamine (1:?)
  • Hexanedioic acid, compd. with N-(2-aminoethyl)-N′-[2-[(2-aminoethyl)amino]ethyl]-1,2-ethanediamine
  • 1,2-Ethanediamine, N-(2-aminoethyl)-N′-[2-[(2-aminoethyl)amino]ethyl]-, hexanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.