CymitQuimica logo

CAS 94135-98-5

:

1,3-Benzodioxole-4-butanoic acid

Description:
1,3-Benzodioxole-4-butanoic acid, identified by its CAS number 94135-98-5, is an organic compound characterized by its unique structure that features a benzodioxole moiety and a butanoic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. It is likely to be a white to off-white solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid group. The benzodioxole structure may impart some degree of stability and influence its interaction with biological systems, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound may exhibit various functional properties, such as potential antioxidant or anti-inflammatory activities, although specific biological activities would require empirical investigation. Overall, 1,3-Benzodioxole-4-butanoic acid represents a compound of interest for further research in organic synthesis and potential therapeutic applications.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c12-10(13)6-2-4-8-3-1-5-9-11(8)15-7-14-9/h1,3,5H,2,4,6-7H2,(H,12,13)
InChI key:InChIKey=LQOVFVGJOQVSNS-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)C1=C2C(OCO2)=CC=C1
Synonyms:
  • 1,3-Benzodioxole-4-butanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.