
CAS 94138-90-6
:N-3-Thienylglycine
Description:
N-3-Thienylglycine is an organic compound characterized by its thienyl group, which is a five-membered aromatic ring containing sulfur. This compound features a glycine moiety, making it an amino acid derivative. It is known for its potential biological activity, particularly in the context of neuropharmacology, where it may act as a modulator of neurotransmitter systems. The presence of the thienyl group can influence its solubility, stability, and interaction with biological targets. N-3-Thienylglycine is typically synthesized through specific organic reactions that involve the coupling of thienyl derivatives with glycine or its precursors. Its chemical properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions of synthesis and purification. As a compound of interest in medicinal chemistry, it may be studied for its potential therapeutic applications, including its role in modulating synaptic transmission or as a scaffold for drug development. However, detailed studies are necessary to fully understand its pharmacological profile and potential uses.
Formula:C6H7NO2S
InChI:InChI=1S/C6H7NO2S/c8-6(9)3-7-5-1-2-10-4-5/h1-2,4,7H,3H2,(H,8,9)
InChI key:InChIKey=VJQOUHZVZWHSNW-UHFFFAOYSA-N
SMILES:N(CC(O)=O)C=1C=CSC1
Synonyms:- 2-[(Thiophen-3-yl)amino]acetic acid
- Glycine, N-3-thienyl-
- 2-(Thiophen-3-ylamino)acetic acid
- N-3-Thienylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.