CAS 94148-67-1
:4,4′-[[1,1′-Biphenyl]-2,5-diylbis(oxy)]bis[benzenamine]
Description:
4,4′-[[1,1′-Biphenyl]-2,5-diylbis(oxy)]bis[benzenamine], with the CAS number 94148-67-1, is an organic compound characterized by its complex structure that includes biphenyl and amine functionalities. This substance typically exhibits properties associated with aromatic compounds, such as stability and potential for pi-pi stacking interactions due to its conjugated system. It is likely to be a solid at room temperature, given its molecular structure, and may have applications in materials science, particularly in the development of polymers or as a dye intermediate. The presence of multiple amine groups suggests potential for hydrogen bonding, which could influence its solubility and reactivity. Additionally, the compound may exhibit interesting electronic properties, making it a candidate for use in organic electronics or as a ligand in coordination chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C24H20N2O2
InChI:InChI=1S/C24H20N2O2/c25-18-6-10-20(11-7-18)27-22-14-15-24(28-21-12-8-19(26)9-13-21)23(16-22)17-4-2-1-3-5-17/h1-16H,25-26H2
InChI key:InChIKey=JWRLKLYWXKMAFL-UHFFFAOYSA-N
SMILES:O(C1=C(C=C(OC2=CC=C(N)C=C2)C=C1)C3=CC=CC=C3)C4=CC=C(N)C=C4
Synonyms:- 2,5-Bis(4-aminophenoxy)biphenyl
- 4,4'-[Biphenyl-2,5-Diylbis(Oxy)]Dianiline
- 4,4′-[(2-Phenyl-p-phenylene)dioxy]dianiline
- 4,4′-[[1,1′-Biphenyl]-2,5-diylbis(oxy)]bis[benzenamine]
- Benzenamine, 4,4′-[[1,1′-biphenyl]-2,5-diylbis(oxy)]bis-
- Papb
- 1,4-Bis(4-aminophenoxy)-2-phenylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
