CAS 94157-94-5

1-[2-(2-Hydroxyethyl)-1-pyrrolidinyl]ethanone

Description:

1-[2-(2-Hydroxyethyl)-1-pyrrolidinyl]ethanone, with the CAS number 94157-94-5, is a chemical compound that features a pyrrolidine ring substituted with a hydroxyethyl group and an ethanone moiety. This compound is characterized by its molecular structure, which includes a five-membered nitrogen-containing ring that contributes to its potential biological activity. The presence of the hydroxyethyl group suggests that it may exhibit hydrophilic properties, enhancing its solubility in polar solvents. Additionally, the ethanone functional group indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. The compound's unique structure may also imply potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.

Formula: C₈H₁₅NO₂

InChI: InChI=1S/C8H15NO2/c1-7(11)9-5-2-3-8(9)4-6-10/h8,10H,2-6H2,1H3

InChI key: InChIKey=YFIUCVYOKJUGSF-UHFFFAOYSA-N

SMILES: C(C)(=O)N1C(CCO)CCC1

Synonyms:

• 1-[2-(2-Hydroxyethyl)-1-pyrrolidinyl]ethanone
• Ethanone, 1-[2-(2-hydroxyethyl)-1-pyrrolidinyl]-
• 2-Pyrrolidineethanol, 1-acetyl-