CymitQuimica logo

CAS 94158-39-1

:

2-Butenedioic acid, mono(3,6,9,12,15,18,21-heptaoxanonatriacont-1-yl) ester

Description:
2-Butenedioic acid, mono(3,6,9,12,15,18,21-heptaoxanonatriacont-1-yl) ester, also known by its CAS number 94158-39-1, is a complex organic compound characterized by its ester functional group derived from 2-butenedioic acid (also known as maleic acid) and a long-chain polyether alcohol. This compound features a hydrophilic segment due to the presence of multiple ether linkages, which enhances its solubility in polar solvents, while the butenedioic acid moiety contributes to its reactivity and potential applications in polymer chemistry. The structure suggests that it may exhibit properties typical of surfactants or emulsifiers, making it useful in various industrial applications, including coatings, adhesives, and as a dispersant. Additionally, the presence of multiple oxygen atoms in the structure indicates potential for hydrogen bonding, which can influence its physical properties such as melting point, boiling point, and viscosity. Overall, this compound's unique structure positions it as a versatile material in chemical synthesis and formulation.
Formula:C36H68O11
InChI:InChI=1S/C36H68O11/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-40-21-22-41-23-24-42-25-26-43-27-28-44-29-30-45-31-32-46-33-34-47-36(39)19-18-35(37)38/h18-19H,2-17,20-34H2,1H3,(H,37,38)
InChI key:InChIKey=LFTOSWHCXZSBCJ-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOCCOCCOCCCCCCCCCCCCCCCCCC)COC(C=CC(O)=O)=O
Synonyms:
  • (3,6,9,12,15,18,21-Heptoxanonatriacontyl) hydrogen but-2-ene-1,4-dioate
  • 2-Butenedioic acid, mono(3,6,9,12,15,18,21-heptaoxanonatriacont-1-yl) ester
  • 4-[2-[2-[2-[2-[2-[2-(2-octadecoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxo-but-2-enoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.