CAS 94158-62-0
:1-[2-(2-Butoxyethoxy)ethoxy]-4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-(trifluoromethyl)-2-undecanol
Description:
1-[2-(2-Butoxyethoxy)ethoxy]-4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-(trifluoromethyl)-2-undecanol, with CAS number 94158-62-0, is a fluorinated alcohol characterized by its complex structure that includes multiple fluorinated carbon chains and ether functionalities. This compound typically exhibits low surface tension and high thermal stability due to the presence of fluorine atoms, which impart unique hydrophobic and lipophobic properties. Its ether groups contribute to solubility in organic solvents, while the alcohol functional group can engage in hydrogen bonding, enhancing its reactivity in various chemical processes. The presence of both hydrophobic fluorinated segments and hydrophilic alcohol moieties allows for potential applications in surfactants, emulsifiers, or as intermediates in the synthesis of more complex fluorinated compounds. Additionally, the compound's stability and resistance to degradation make it suitable for use in harsh chemical environments. However, the environmental impact and regulatory considerations of fluorinated compounds should be taken into account when evaluating its applications.
Formula:C20H23F19O4
InChI:InChI=1S/C20H23F19O4/c1-2-3-4-41-5-6-42-7-8-43-10-11(40)9-12(21,22)14(24,25)16(28,29)18(32,33)17(30,31)15(26,27)13(23,19(34,35)36)20(37,38)39/h11,40H,2-10H2,1H3
InChI key:InChIKey=AGXPCTAFKVXMEO-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)(C(F)(F)F)F)(C(C(C(C(C(CC(COCCOCCOCCCC)O)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- 1-[2-(2-Butoxyethoxy)ethoxy]-4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-(trifluoromethyl)-2-undecanol
- 1-(2-(2-Butoxyethoxy)ethoxy)-4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-(trifluoromethyl)undecan-2-ol
- 2-Undecanol, 1-[2-(2-butoxyethoxy)ethoxy]-4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-[2-(2-Butoxyethoxy)Ethoxy]-4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-Hexadecafluoro-10-(Trifluoromethyl)Undecan-2-Ol
CAS:Formula:C20H23F19O4Molecular weight:688.3639
