CymitQuimica logo

CAS 94159-17-8

:

Diphosphoric acid, compd. with 1,3,5-triazine-2,4,6-triamine (1:4)

Description:
Diphosphoric acid, compd. with 1,3,5-triazine-2,4,6-triamine (1:4), identified by its CAS number 94159-17-8, is a chemical compound that exhibits characteristics typical of both phosphoric acids and triazine derivatives. This compound likely features a complex structure where diphosphoric acid is coordinated with a triazine-based amine, which can influence its solubility, reactivity, and potential applications. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including acid-base interactions and coordination chemistry. Additionally, the triazine component may impart specific properties such as thermal stability and potential use in agricultural or industrial applications, particularly as a fertilizer or in polymer formulations. The compound's unique stoichiometry (1:4 ratio) indicates a specific molecular arrangement that could affect its physical properties, such as melting point and solubility in different solvents. Overall, this compound represents an interesting intersection of phosphoric acid chemistry and nitrogen-rich heterocycles, warranting further investigation for its potential uses.
Formula:C3H6N6H4O7P2
InChI:InChI=1S/C3H6N6.H4O7P2/c4-1-7-2(5)9-3(6)8-1;1-8(2,3)7-9(4,5)6/h(H6,4,5,6,7,8,9);(H2,1,2,3)(H2,4,5,6)
InChI key:InChIKey=XZTOTRSSGPPNTB-UHFFFAOYSA-N
SMILES:O(P(=O)(O)O)P(=O)(O)O.NC=1N=C(N)N=C(N)N1
Synonyms:
  • 1,3,5-Triazine-2,4,6-triamine, (diphosphate) (4:1)
  • Diphosphoric acid, compd. with 1,3,5-triazine-2,4,6-triamine (1:4)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.