CymitQuimica logo

CAS 94159-20-3

:

Boric acid (H3BO3), compd. with 1,3,5-triazine-2,4,6-triamine (1:1)

Description:
Boric acid (H3BO3) is a weak acid that exhibits antiseptic, insecticidal, and antifungal properties, commonly used in various applications, including agriculture and medicine. When it forms a compound with 1,3,5-triazine-2,4,6-triamine, also known as melamine, in a 1:1 molar ratio, it creates a complex that may enhance the properties of both substances. This compound can exhibit improved thermal stability and may be utilized in the development of flame retardants or as a component in polymer formulations. The interaction between boric acid and melamine can lead to the formation of hydrogen bonds, influencing the material's physical and chemical characteristics. The resulting compound may also display unique solubility and reactivity profiles, making it of interest in various industrial applications. Safety considerations should be taken into account, as both boric acid and melamine have specific handling guidelines due to their potential toxicity and environmental impact. Overall, this compound represents a fascinating area of study in materials science and chemistry.
Formula:C3H6N6·BH3O3
InChI:InChI=1S/C3H6N6.BH3O3/c4-1-7-2(5)9-3(6)8-1;2-1(3)4/h(H6,4,5,6,7,8,9);2-4H
InChI key:InChIKey=IUTYMBRQELGIRS-UHFFFAOYSA-N
SMILES:B(O)(O)O.NC=1N=C(N)N=C(N)N1
Synonyms:
  • Boric acid (H3BO3), compd. with 1,3,5-triazine-2,4,6-triamine (1:1)
  • 1,3,5-Triazine-2,4,6-triamine, compd. with boric acid (H3BO3) (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.