
CAS 94160-16-4
:L-Lysine, phosphate (1:1)
Description:
L-Lysine phosphate (1:1) is a chemical compound that consists of the amino acid L-lysine and phosphate in a 1:1 molar ratio. L-lysine is an essential amino acid, meaning it must be obtained through diet, and plays a crucial role in protein synthesis, hormone production, and enzyme function. The phosphate component contributes to various biological processes, including energy transfer and cellular signaling. This compound is typically found in a crystalline form and is soluble in water, making it bioavailable for various applications, particularly in nutrition and pharmaceuticals. L-Lysine phosphate is often used as a dietary supplement to support muscle health, immune function, and overall well-being. Additionally, it may have applications in animal feed to promote growth and improve health in livestock. As with many compounds, safety and efficacy depend on dosage and individual health conditions, so it is essential to consult relevant guidelines or professionals when considering its use.
Formula:C6H14N2O2·H3O4P
InChI:InChI=1S/C6H14N2O2.H3O4P/c7-4-2-1-3-5(8)6(9)10;1-5(2,3)4/h5H,1-4,7-8H2,(H,9,10);(H3,1,2,3,4)/t5-;/m0./s1
InChI key:InChIKey=XAHQYEAIJGTPET-JEDNCBNOSA-N
SMILES:P(=O)(O)(O)O.[C@H](CCCCN)(C(O)=O)N
Synonyms:- L-Lysine, phosphate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lysine phosphate
CAS:<p>Lysine phosphate, as an α-amino acid, is used in the biosynthesis of proteins.</p>Formula:C6H17N2O6PColor and Shape:SolidMolecular weight:244.18
