CAS 94161-07-6
:1-deoxy-1-[methyl(sulfanylcarbothioyl)amino]-D-glucitol
Description:
1-Deoxy-1-[methyl(sulfanylcarbothioyl)amino]-D-glucitol, with the CAS number 94161-07-6, is a chemical compound that features a glucitol backbone modified with a methylthio group and a carbothioamide functional group. This compound is characterized by its structural complexity, which includes a hydroxyl group typical of sugar alcohols, contributing to its potential solubility in polar solvents. The presence of the sulfanyl and carbothioyl groups suggests that it may exhibit unique reactivity, particularly in nucleophilic substitution reactions or as a potential ligand in coordination chemistry. Additionally, the compound's modifications may influence its biological activity, making it of interest in medicinal chemistry and biochemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature references for precise values. Overall, this compound represents a fascinating intersection of carbohydrate chemistry and sulfur chemistry, with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H17NO5S2
InChI:InChI=1/C8H17NO5S2/c1-9(8(15)16)2-4(11)6(13)7(14)5(12)3-10/h4-7,10-14H,2-3H2,1H3,(H,15,16)/t4-,5+,6+,7+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Norathiol
CAS:<p>Norathiol (N-methyl-N-dithiocarboxyglucamine) is a metal chelator that promotes the excretion of 109Cd and may be used in the treatment of cadmium poisoning.</p>Formula:C8H17NO5S2Color and Shape:SolidMolecular weight:271.35
