CymitQuimica logo

CAS 94166-57-1

:

N-Ethyl-6-methoxy-3-nitro-2-pyridinamine

Description:
N-Ethyl-6-methoxy-3-nitro-2-pyridinamine is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl group and a methoxy group attached to the pyridine ring, as well as a nitro group, which contributes to its chemical reactivity and potential biological activity. The presence of the methoxy group typically enhances lipophilicity, potentially influencing the compound's solubility and permeability in biological systems. The nitro group is known for its electron-withdrawing properties, which can affect the compound's reactivity and interaction with other molecules. N-Ethyl-6-methoxy-3-nitro-2-pyridinamine may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and effects would depend on further studies, including its synthesis, stability, and biological activity. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C8H11N3O3
InChI:InChI=1S/C8H11N3O3/c1-3-9-8-6(11(12)13)4-5-7(10-8)14-2/h4-5H,3H2,1-2H3,(H,9,10)
InChI key:InChIKey=ASUQBRULJIRHPC-UHFFFAOYSA-N
SMILES:N(CC)C1=C(N(=O)=O)C=CC(OC)=N1
Synonyms:
  • N-Ethyl-6-methoxy-3-nitro-2-pyridinamine
  • 2-Pyridinamine, N-ethyl-6-methoxy-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.