CymitQuimica logo

CAS 941672-66-8

:

4-hydroxy-1-(4-piperidyl)pyrrolidin-2-one

Description:
4-Hydroxy-1-(4-piperidyl)pyrrolidin-2-one, with the CAS number 941672-66-8, is a chemical compound characterized by its unique structural features, which include a pyrrolidinone ring and a piperidine moiety. This compound typically exhibits properties associated with both cyclic amines and lactams, contributing to its potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. It is often studied in the context of medicinal chemistry for its potential therapeutic applications, particularly in neuropharmacology, due to the piperidine ring's role in modulating neurotransmitter systems. The compound's stability, reactivity, and pharmacokinetic properties can be influenced by factors such as pH and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use. Further research is necessary to fully elucidate its mechanisms of action and therapeutic potential.
Formula:C9H16N2O2
InChI:InChI=1/C9H16N2O2/c12-8-5-9(13)11(6-8)7-1-3-10-4-2-7/h7-8,10,12H,1-6H2
SMILES:C1CNCCC1N1CC(CC1=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.