CymitQuimica logo

CAS 941672-67-9

:

4-Hydroxy-1-[1-(phenylmethyl)-4-piperidinyl]-2-pyrrolidinone

Description:
4-Hydroxy-1-[1-(phenylmethyl)-4-piperidinyl]-2-pyrrolidinone, with the CAS number 941672-67-9, is a chemical compound characterized by its complex structure, which includes a pyrrolidinone ring and a piperidine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of hydroxyl and nitrogen functional groups. It may demonstrate biological activity, particularly in the context of pharmacology, as compounds with similar structures are often investigated for their potential therapeutic effects. The presence of the phenylmethyl group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, reactivity, and potential for forming hydrogen bonds can influence its behavior in various chemical environments. Overall, 4-Hydroxy-1-[1-(phenylmethyl)-4-piperidinyl]-2-pyrrolidinone represents a class of compounds that may have significant implications in drug development and research.
Formula:C16H22N2O2
InChI:InChI=1S/C16H22N2O2/c19-15-10-16(20)18(12-15)14-6-8-17(9-7-14)11-13-4-2-1-3-5-13/h1-5,14-15,19H,6-12H2
InChI key:InChIKey=RKRQSWKYYXXBDA-UHFFFAOYSA-N
SMILES:O=C1N(CC(O)C1)C2CCN(CC3=CC=CC=C3)CC2
Synonyms:
  • 2-Pyrrolidinone, 4-hydroxy-1-[1-(phenylmethyl)-4-piperidinyl]-
  • 1-(1-Benzylpiperidin-4-yl)-4-hydroxypyrrolidin-2-one
  • 4-Hydroxy-1-[1-(phenylmethyl)-4-piperidinyl]-2-pyrrolidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.