CAS 941685-20-7

B-(2-Phenyl-5-thiazolyl)boronic acid

Description:

B-(2-Phenyl-5-thiazolyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thiazole ring substituted with a phenyl group. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and alcohols, which is common for boronic acids. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The thiazole moiety contributes to its biological activity, potentially enhancing its interaction with biological targets. Additionally, this compound may exhibit properties such as fluorescence or photostability, depending on its specific structure and substituents. Its reactivity and functional versatility make it a valuable building block in the synthesis of complex organic molecules. As with many boronic acids, it should be handled with care due to potential reactivity with moisture and other nucleophiles.

Formula: C₉H₈BNO₂S

InChI: InChI=1S/C9H8BNO2S/c12-10(13)8-6-11-9(14-8)7-4-2-1-3-5-7/h1-6,12-13H

InChI key: InChIKey=ICEGEOGENFNGQA-UHFFFAOYSA-N

SMILES: B(O)(O)C=1SC(=NC1)C2=CC=CC=C2

Synonyms:

• (2-Phenyl-1,3-thiazol-5-yl)boronic acid
• (2-Phenylthiazol-5-yl)boronic acid
• B-(2-Phenyl-5-thiazolyl)boronic acid
• Boronic acid, B-(2-phenyl-5-thiazolyl)-