CAS 941711-38-2

Piperidine, 4-(2,4-difluorophenyl)-, hydrochloride (1:1)

Description:

Piperidine, 4-(2,4-difluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 2,4-difluorophenyl group indicates that two fluorine atoms are substituted on a phenyl ring at the 2 and 4 positions, enhancing its chemical reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the presence of fluorine atoms often contributes to increased metabolic stability and lipophilicity, influencing the compound's bioavailability. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₁H₁₄ClF₂N

InChI: InChI=1/C11H13F2N.ClH/c12-9-1-2-10(11(13)7-9)8-3-5-14-6-4-8;/h1-2,7-8,14H,3-6H2;1H

SMILES: c1cc(C2CCNCC2)c(cc1F)F.Cl

Synonyms:

• 4-(2,4-Difluorophenyl)-piperidine hydrochloride