CAS 941716-82-1

[1-(6-methylpyrazin-2-yl)-3-piperidyl]methanamine

Description:

[1-(6-methylpyrazin-2-yl)-3-piperidyl]methanamine, with the CAS number 941716-82-1, is a chemical compound characterized by its unique structural features, which include a pyrazine ring and a piperidine moiety. The presence of the 6-methylpyrazin-2-yl group contributes to its potential biological activity, as pyrazine derivatives are often associated with various pharmacological properties. The piperidyl group enhances the compound's ability to interact with biological targets, potentially influencing its solubility and permeability. This compound is likely to exhibit basic properties due to the amine functional group, which can participate in hydrogen bonding and ionic interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. However, specific biological activities, toxicity, and pharmacokinetic profiles would require further investigation through experimental studies. Overall, [1-(6-methylpyrazin-2-yl)-3-piperidyl]methanamine represents a compound of interest in the field of drug discovery and development.

Formula: C₁₁H₁₈N₄

InChI: InChI=1/C11H18N4/c1-9-6-13-7-11(14-9)15-4-2-3-10(5-12)8-15/h6-7,10H,2-5,8,12H2,1H3

SMILES: Cc1cncc(n1)N1CCCC(CN)C1

2-[(3-Aminomethyl)piperidin-1-yl]-6-methylpyrazine

CAS: 941716-82-1

2-[(3-Aminomethyl)piperidin-1-yl]-6-methylpyrazine

Purity: 97%

Molecular weight: 206.29g/mol

Ref: 54-OR15952