CAS 941716-90-1
:N-Methyl-4-(phenoxymethyl)benzenemethanamine
Description:
N-Methyl-4-(phenoxymethyl)benzenemethanamine, identified by its CAS number 941716-90-1, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with both a phenoxymethyl group and a methylamino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the phenoxy group may impart additional characteristics, such as potential interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. However, detailed information regarding its reactivity, stability, and specific applications may require further investigation through experimental studies and literature reviews. As with many organic compounds, safety data and handling precautions should be considered, especially in laboratory settings.
Formula:C15H17NO
InChI:InChI=1S/C15H17NO/c1-16-11-13-7-9-14(10-8-13)12-17-15-5-3-2-4-6-15/h2-10,16H,11-12H2,1H3
InChI key:InChIKey=PSMWUOSOWNRPOJ-UHFFFAOYSA-N
SMILES:C(OC1=CC=CC=C1)C2=CC=C(CNC)C=C2
Synonyms:- Benzenemethanamine, N-methyl-4-(phenoxymethyl)-
- N-Methyl-4-(phenoxymethyl)benzenemethanamine
- N-METHYL-4-(PHENOXYMETHYL)BENZYLAMINE
- N-methyl-1-[4-(phenoxymethyl)phenyl]methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.