CymitQuimica logo

CAS 941717-12-0

:

9H-Fluoren-9-ylmethyl 4-(aminothioxomethyl)-1-piperidinecarboxylate

Description:
9H-Fluoren-9-ylmethyl 4-(aminothioxomethyl)-1-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes a fluorenyl group, a piperidine ring, and an aminothioxomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the piperidine moiety suggests it may interact with biological targets, possibly influencing neurotransmitter systems or enzyme activity. The aminothioxomethyl group may impart unique reactivity or binding characteristics, making it of interest in medicinal chemistry. Additionally, the fluorenyl group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics and bioavailability. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound may be explored for its potential applications in drug development or as a research tool in biochemical studies.
Formula:C21H22N2O2S
InChI:InChI=1S/C21H22N2O2S/c22-20(26)14-9-11-23(12-10-14)21(24)25-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,14,19H,9-13H2,(H2,22,26)
InChI key:InChIKey=URQBPQRQAPSGOQ-UHFFFAOYSA-N
SMILES:C(OC(=O)N1CCC(C(N)=S)CC1)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:
  • 1-Piperidinecarboxylic acid, 4-(aminothioxomethyl)-, 9H-fluoren-9-ylmethyl ester
  • 9H-Fluoren-9-ylmethyl 4-(aminothioxomethyl)-1-piperidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.