CAS 941867-25-0

5-(3-Methyl-1-piperidinyl)-1,3,4-thiadiazol-2-amine

Description:

5-(3-Methyl-1-piperidinyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a piperidine moiety. The presence of the thiadiazole ring contributes to its potential biological activity, as this heterocyclic structure is often associated with various pharmacological properties. The piperidine group, which contains a nitrogen atom in a six-membered ring, enhances the compound's ability to interact with biological targets, potentially influencing its solubility and permeability. This compound may exhibit properties such as antimicrobial, anti-inflammatory, or neuroprotective effects, making it of interest in medicinal chemistry. Its molecular formula and specific functional groups can influence its reactivity and interactions with other substances. As with many compounds, the safety and toxicity profiles would need to be evaluated through appropriate studies to determine its suitability for any therapeutic applications. Overall, 5-(3-Methyl-1-piperidinyl)-1,3,4-thiadiazol-2-amine represents a class of compounds that may hold promise in drug development.

Formula: C₈H₁₄N₄S

InChI: InChI=1S/C8H14N4S/c1-6-3-2-4-12(5-6)8-11-10-7(9)13-8/h6H,2-5H2,1H3,(H2,9,10)

InChI key: InChIKey=QNJGKWHCNPFPQO-UHFFFAOYSA-N

SMILES: CC1CN(CCC1)C2=NN=C(N)S2

Synonyms:

• 5-(3-Methyl-1-piperidinyl)-1,3,4-thiadiazol-2-amine
• 1,3,4-Thiadiazol-2-amine, 5-(3-methyl-1-piperidinyl)-