
CAS 941867-91-0
:4-(benzyloxy)-1-fluoro-2-nitrobenzene
Description:
4-(Benzyloxy)-1-fluoro-2-nitrobenzene is an organic compound characterized by its unique functional groups and structural features. It contains a nitro group (-NO2), a fluoro group (-F), and a benzyloxy group (-O-Ph), which significantly influence its chemical reactivity and physical properties. The presence of the fluoro substituent typically enhances the compound's electrophilicity, while the nitro group can serve as a strong electron-withdrawing group, affecting the compound's overall electron density. The benzyloxy group contributes to the compound's solubility in organic solvents and may also influence its reactivity in nucleophilic substitution reactions. This compound is likely to exhibit moderate stability under standard conditions but may undergo reactions typical of aromatic compounds, such as electrophilic aromatic substitution. Its applications could span various fields, including pharmaceuticals and materials science, where such substituted aromatic compounds are often utilized as intermediates or building blocks in synthesis. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose health risks.
Formula:C13H10FNO3
InChI:InChI=1/C13H10FNO3/c14-12-7-6-11(8-13(12)15(16)17)18-9-10-4-2-1-3-5-10/h1-8H,9H2
SMILES:c1ccc(cc1)COc1ccc(c(c1)N(=O)=O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
