CymitQuimica logo

CAS 941868-25-3

:

1-(5-Amino-2-methylphenyl)-2-piperidinone

Description:
1-(5-Amino-2-methylphenyl)-2-piperidinone, identified by its CAS number 941868-25-3, is an organic compound characterized by its structural features, which include a piperidinone ring and an amino-substituted aromatic ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of both amino and carbonyl functional groups. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the methyl group on the aromatic ring may affect its electronic properties and steric hindrance, which can be significant in biological systems or when used as a pharmaceutical intermediate. The compound may also exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to further studies to explore its potential applications in drug development or other fields.
Formula:C12H16N2O
InChI:InChI=1S/C12H16N2O/c1-9-5-6-10(13)8-11(9)14-7-3-2-4-12(14)15/h5-6,8H,2-4,7,13H2,1H3
InChI key:InChIKey=ROFVFYUZNNIHNE-UHFFFAOYSA-N
SMILES:CC1=C(C=C(N)C=C1)N2C(=O)CCCC2
Synonyms:
  • 1-(5-Amino-2-methylphenyl)-2-piperidinone
  • 2-Piperidinone, 1-(5-amino-2-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.