CymitQuimica logo

CAS 941868-39-9

:

1-(8-Hydroxy-2-quinolinyl)-4-piperidinecarboxamide

Description:
1-(8-Hydroxy-2-quinolinyl)-4-piperidinecarboxamide, with the CAS number 941868-39-9, is a chemical compound characterized by its unique structural features, which include a quinoline moiety and a piperidine ring. The presence of the hydroxyl group at the 8-position of the quinoline enhances its potential for hydrogen bonding and may influence its solubility and reactivity. This compound is often studied for its biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties such as antimicrobial or anticancer effects. The piperidinecarboxamide portion contributes to its pharmacological profile, potentially affecting its interaction with biological targets. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, making it of interest for further research in drug development and synthesis. Overall, the characteristics of this compound highlight its potential utility in various scientific fields, particularly in the development of therapeutic agents.
Formula:C15H17N3O2
InChI:InChI=1S/C15H17N3O2/c16-15(20)11-6-8-18(9-7-11)13-5-4-10-2-1-3-12(19)14(10)17-13/h1-5,11,19H,6-9H2,(H2,16,20)
InChI key:InChIKey=NGGDOPGMIFFQPX-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=CC(=N2)N3CCC(C(N)=O)CC3)C=CC1
Synonyms:
  • 4-Piperidinecarboxamide, 1-(8-hydroxy-2-quinolinyl)-
  • 1-(8-Hydroxy-2-quinolinyl)-4-piperidinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.