CAS 94191-13-6
:3-Iodothieno[3,2-b]pyridine
Description:
3-Iodothieno[3,2-b]pyridine is a heterocyclic organic compound characterized by the presence of both iodine and a thieno-pyridine structure. This compound features a fused ring system that includes a thiophene and a pyridine, contributing to its unique chemical properties. The iodine atom introduces significant reactivity, making it a useful intermediate in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The presence of the thieno group enhances its electron-rich character, which can influence its reactivity and interactions with other molecules. Additionally, 3-Iodothieno[3,2-b]pyridine may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and conditions, which is important for its application in research and industry. Overall, this compound exemplifies the diverse chemistry of heterocycles and their potential utility in various fields.
Formula:C7H4INS
InChI:InChI=1S/C7H4INS/c8-5-4-10-6-2-1-3-9-7(5)6/h1-4H
InChI key:InChIKey=XYYGJSAXZJZKTI-UHFFFAOYSA-N
SMILES:IC=1C=2C(=CC=CN2)SC1
Synonyms:- 3-Iodothieno[3,2-b]pyridine
- Thieno[3,2-b]pyridine, 3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
