
CAS 94191-14-7
:2-Chlorothieno[3,2-b]pyridine
Description:
2-Chlorothieno[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 2-position of the thieno ring enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish appearance and has a relatively low molecular weight. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The structure of 2-Chlorothieno[3,2-b]pyridine allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, it may exhibit interesting electronic properties owing to the conjugated system formed by the thieno and pyridine moieties. Safety data should be consulted for handling, as with many chlorinated compounds, it may pose environmental and health risks. Overall, 2-Chlorothieno[3,2-b]pyridine is a significant compound in the field of organic chemistry and drug development.
Formula:C7H4ClNS
InChI:InChI=1S/C7H4ClNS/c8-7-4-5-6(10-7)2-1-3-9-5/h1-4H
InChI key:InChIKey=WFXIHXBAHAGHCI-UHFFFAOYSA-N
SMILES:ClC1=CC=2C(S1)=CC=CN2
Synonyms:- 2-Chlorothieno[3,2-b]pyridine
- Thieno[3,2-b]pyridine, 2-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
