CAS 942-25-6
:1-(1-methyl-1H-benzimidazol-2-yl)ethanone
Description:
1-(1-Methyl-1H-benzimidazol-2-yl)ethanone, with the CAS number 942-25-6, is an organic compound characterized by its benzimidazole structure, which consists of a fused benzene and imidazole ring. This compound features a ketone functional group (ethanone) attached to the benzimidazole moiety, contributing to its reactivity and potential applications in various chemical processes. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the methyl group on the benzimidazole ring can influence its electronic properties and biological activity. Compounds of this type are often studied for their pharmacological properties, including potential antimicrobial or anticancer activities. Additionally, the structural features of 1-(1-methyl-1H-benzimidazol-2-yl)ethanone may allow for interactions with biological targets, making it of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C10H10N2O
InChI:InChI=1/C10H10N2O/c1-7(13)10-11-8-5-3-4-6-9(8)12(10)2/h3-6H,1-2H3
SMILES:CC(=O)c1nc2ccccc2n1C
Synonyms:- ethanone, 1-(1-methyl-1H-benzimidazol-2-yl)-
- 1-(1-Methyl-1H-benzimidazol-2-yl)ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-(1-Methyl-1H-benzimidazol-2-yl)ethanone
CAS:Formula:C10H10N2OPurity:95.0%Color and Shape:SolidMolecular weight:174.2031-(1-Methyl-1H-benzimidazol-2-yl)ethanone
CAS:Controlled Product1-(1-Methyl-1H-benzimidazol-2-yl)ethanone (1MBZ) is a chemical compound that has been shown to have anti-cancer properties. It inhibits the growth of renal cells in vitro and induces cytotoxicity in breast cancer cells. 1MBZ is an alkylating agent, which has the ability to bind to cellular nucleophiles such as lysine and cysteine. This binding results in the inhibition of DNA synthesis and protein synthesis. 1MBZ also binds to DNA via intercalation with high selectivity for double helix sites, making it a potential candidate for anti-HIV agents.Formula:C10H10N2OPurity:Min. 95%Molecular weight:174.2 g/mol


