CAS 942-60-9
:5-Phenyl-1,2,4-triazin-3-amine
Description:
5-Phenyl-1,2,4-triazin-3-amine, with the CAS number 942-60-9, is an organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. This compound features a phenyl group attached to the triazine ring, contributing to its aromatic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its structure allows for various chemical modifications, which can enhance its reactivity and application in synthetic chemistry. Safety data sheets should be consulted for handling and storage guidelines, as with many nitrogen-containing heterocycles, it may pose certain health risks if not managed properly. Overall, 5-Phenyl-1,2,4-triazin-3-amine is a versatile compound with significant implications in chemical research and development.
Formula:C9H8N4
InChI:InChI=1S/C9H8N4/c10-9-12-8(6-11-13-9)7-4-2-1-3-5-7/h1-6H,(H2,10,12,13)
InChI key:InChIKey=IJXBFQUBVHTXGX-UHFFFAOYSA-N
SMILES:NC=1N=C(C=NN1)C2=CC=CC=C2
Synonyms:- 1,2,4-Triazin-3-amine, 5-phenyl-
- 3-Amino-5-phenyl-as-triazine
- NSC 98929
- as-Triazine, 3-amino-5-phenyl-
- 5-Phenyl-1,2,4-triazin-3-amine
- 5-Phenyl-1,2,4-triazin-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Phenyl-1,2,4-triazin-3-amine
CAS:Controlled ProductApplications 5-PHENYL-1,2,4-TRIAZIN-3-AMINE (cas# 942-60-9) is a useful research chemical.
Formula:C9H8N4Color and Shape:Light YellowMolecular weight:172.18
