CAS 94201-19-1

8-Methyl-1-oxaspiro[4.5]decan-2-one

Description:

8-Methyl-1-oxaspiro[4.5]decan-2-one is a chemical compound characterized by its unique spirocyclic structure, which features a ketone functional group and an ether linkage. The presence of the spiro configuration indicates that the molecule contains two rings that share a single atom, contributing to its distinct three-dimensional shape. This compound is typically classified as a cyclic ketone and may exhibit properties such as moderate volatility and solubility in organic solvents, depending on its molecular interactions. The methyl group at the 8-position can influence its reactivity and stability, potentially affecting its applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the compound may possess specific biological activities, making it of interest in medicinal chemistry. However, detailed studies on its physical and chemical properties, as well as its potential applications, would be necessary to fully understand its behavior and utility in various chemical contexts.

Formula: C₁₀H₁₆O₂

InChI: InChI=1S/C10H16O2/c1-8-2-5-10(6-3-8)7-4-9(11)12-10/h8H,2-7H2,1H3

InChI key: InChIKey=COWIMPXRUUJKQF-UHFFFAOYSA-N

SMILES: O=C1OC2(CCC(C)CC2)CC1

Synonyms:

• 1-Oxaspiro[4.5]decan-2-one, 8-methyl-
• Methyl laitone
• 8-Methyl-1-oxaspiro[4.5]decan-2-one