CAS 94201-39-5

2,3-Dibromobenzenepropanoic acid

Description:

2,3-Dibromobenzenepropanoic acid, with the CAS number 94201-39-5, is an organic compound characterized by the presence of a propanoic acid functional group attached to a dibromobenzene ring. This compound features two bromine atoms located at the 2 and 3 positions of the benzene ring, which significantly influences its chemical properties and reactivity. The presence of the bromine substituents enhances the compound's electrophilicity, making it more reactive in nucleophilic substitution reactions. Additionally, the carboxylic acid group contributes to its acidity and solubility in polar solvents. The compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its physical properties, such as melting point and boiling point, are influenced by the molecular structure and the presence of bromine atoms, which can also affect its environmental behavior and toxicity. Overall, 2,3-Dibromobenzenepropanoic acid is a valuable compound in organic synthesis and research applications.

Formula: C₉H₈Br₂O₂

InChI: InChI=1S/C9H8Br2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-3H,4-5H2,(H,12,13)

InChI key: InChIKey=YJZYPZACUFTIIA-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C1=C(Br)C(Br)=CC=C1

Synonyms:

• Benzenepropanoic acid, 2,3-dibromo-
• 2,3-Dibromobenzenepropanoic acid