CAS 94201-40-8

1-Phenyl-4-piperidinecarboxylic acid

Description:

1-Phenyl-4-piperidinecarboxylic acid, with the CAS number 94201-40-8, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a phenyl group attached to the piperidine at the 1-position and a carboxylic acid functional group at the 4-position. It is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties. Its structure allows for various chemical modifications, which can influence its biological activity. Additionally, the presence of both the aromatic phenyl group and the piperidine moiety may contribute to its interactions with biological targets. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1S/C12H15NO2/c14-12(15)10-6-8-13(9-7-10)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,14,15)

InChI key: InChIKey=IXLCEJNZWAYHPL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CCN(CC1)C2=CC=CC=C2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-phenyl-
• 1-Phenylpiperidine-4-carboxylic acid
• 1-Phenyl-4-piperidinecarboxylic acid

1-Phenylpiperidine-4-carboxylic acid

CAS: 94201-40-8

Formula: C₁₂H₁₅NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.2530

Ref: IN-DA00GYJR

1-Phenylpiperidine-4-carboxylic acid

CAS: 94201-40-8

1-Phenylpiperidine-4-carboxylic acid

Purity: 98%

Molecular weight: 205.257g/mol

Ref: 54-OR75057

1-Phenylpiperidine-4-carboxylic acid

CAS: 94201-40-8

Formula: C₁₂H₁₅NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.257

Ref: 10-F220355