CymitQuimica logo

CAS 94201-43-1

:

Acetic acid, 2,2′-[oxybis(2,1-ethanediyloxy)]bis-, dipotassium salt

Description:
Acetic acid, 2,2′-[oxybis(2,1-ethanediyloxy)]bis-, dipotassium salt, commonly referred to as dipotassium salt of a specific acetic acid derivative, is a chemical compound characterized by its dual potassium cation presence and its structure that includes ether linkages. This compound is typically a white crystalline solid that is soluble in water, reflecting its ionic nature. It is often used in various applications, including as a buffering agent in biochemical and pharmaceutical formulations, due to its ability to maintain pH stability. The presence of the acetic acid moiety contributes to its mild acidity, while the dipotassium salt form enhances its solubility and bioavailability. Additionally, this compound may exhibit properties such as being non-toxic and biodegradable, making it suitable for use in food and agricultural applications. Its stability under normal conditions and compatibility with other substances further expand its utility in various industrial and research settings.
Formula:C8H14O7·2K
InChI:InChI=1S/C8H14O7.2K/c9-7(10)5-14-3-1-13-2-4-15-6-8(11)12;;/h1-6H2,(H,9,10)(H,11,12);;
InChI key:InChIKey=MDTFESCMILLOLC-UHFFFAOYSA-N
SMILES:O(CC(O)=O)CCOCCOCC(O)=O.[K]
Synonyms:
  • Acetic acid, 2,2′-[oxybis(2,1-ethanediyloxy)]bis-, dipotassium salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.