CymitQuimica logo

CAS 94201-57-7

:

3,5-Diamino-4-pyridinol

Description:
3,5-Diamino-4-pyridinol, with the CAS number 94201-57-7, is an organic compound characterized by its pyridine ring structure, which contains two amino groups at the 3 and 5 positions and a hydroxyl group at the 4 position. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydroxyl and amino groups, which can engage in hydrogen bonding. It exhibits basic properties, as the amino groups can accept protons, making it a potential candidate for various chemical reactions, including those involving nucleophilic substitution. 3,5-Diamino-4-pyridinol is of interest in medicinal chemistry and may have applications in the synthesis of pharmaceuticals or as a building block in organic synthesis. Its reactivity and functional groups allow for modifications that can lead to derivatives with enhanced biological activity or different chemical properties. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C5H7N3O
InChI:InChI=1S/C5H7N3O/c6-3-1-8-2-4(7)5(3)9/h1-2H,6-7H2,(H,8,9)
InChI key:InChIKey=WFLQGXOIDGIFBA-UHFFFAOYSA-N
SMILES:OC=1C(N)=CN=CC1N
Synonyms:
  • 3,5-Diamino-4-pyridinol
  • 4-Pyridinol, 3,5-diamino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.