CymitQuimica logo

CAS 942025-97-0

:

3-(3-Cyclohexyl-1H-1,2,4-triazol-5-yl)pyridine

Description:
3-(3-Cyclohexyl-1H-1,2,4-triazol-5-yl)pyridine, identified by its CAS number 942025-97-0, is a chemical compound that features a pyridine ring substituted with a triazole moiety. This compound exhibits characteristics typical of heterocyclic compounds, including potential biological activity due to the presence of both the triazole and pyridine functional groups. The cyclohexyl group contributes to its hydrophobic properties, which may influence its solubility and interaction with biological membranes. The triazole ring is known for its role in various pharmacological applications, including antifungal and antimicrobial activities. Additionally, the compound may exhibit coordination chemistry due to the nitrogen atoms in both the triazole and pyridine rings, allowing it to form complexes with metal ions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, this compound represents a unique combination of structural elements that may confer interesting chemical and biological properties.
Formula:C13H16N4
InChI:InChI=1S/C13H16N4/c1-2-5-10(6-3-1)12-15-13(17-16-12)11-7-4-8-14-9-11/h4,7-10H,1-3,5-6H2,(H,15,16,17)
InChI key:InChIKey=CKSUQPRNBBIFGA-UHFFFAOYSA-N
SMILES:C=1(NC(=NN1)C=2C=CC=NC2)C3CCCCC3
Synonyms:
  • Pyridine, 3-(3-cyclohexyl-1H-1,2,4-triazol-5-yl)-
  • 3-(3-Cyclohexyl-1H-1,2,4-triazol-5-yl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.