CymitQuimica logo

CAS 94205-62-6

:

2-(4-aminophenyl)quinoline-4-carboxylic acid

Description:
2-(4-Aminophenyl)quinoline-4-carboxylic acid, identified by its CAS number 94205-62-6, is an organic compound characterized by its quinoline structure, which features a carboxylic acid functional group and an amino group on the phenyl ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid group. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry, due to its potential biological activity, particularly in the development of pharmaceuticals. Its structural features suggest it could act as a ligand in coordination chemistry or as a precursor in organic synthesis. Additionally, the presence of both the amino and carboxylic acid groups may allow for further functionalization, making it a versatile building block in chemical synthesis.
Formula:C16H12N2O2
InChI:InChI=1/C16H12N2O2/c17-11-7-5-10(6-8-11)15-9-13(16(19)20)12-3-1-2-4-14(12)18-15/h1-9H,17H2,(H,19,20)
SMILES:c1ccc2c(c1)c(cc(c1ccc(cc1)N)n2)C(=O)O
Synonyms:
  • 4-Quinolinecarboxylic acid, 2-(4-aminophenyl)-
  • 2-(4-Aminophenyl)quinoline-4-carboxylic acid
  • 4-quinolinecarboxylic acid, 2-(4-aminophenyl)-, ion(1-)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.