CymitQuimica logo

CAS 942069-61-6

:

2-[3-Chloro-5-(phenylthio)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[3-Chloro-5-(phenylthio)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a phenylthio substituent. The presence of the chloro group and the phenylthio moiety contributes to its potential reactivity and solubility properties, making it of interest in various chemical applications, particularly in organic synthesis and medicinal chemistry. The dioxaborolane structure is known for its ability to participate in reactions such as Suzuki coupling, which is valuable in forming carbon-carbon bonds. This compound may exhibit specific physical properties such as a distinct melting point and solubility in organic solvents, influenced by its molecular structure. Additionally, its boron content may impart unique electronic properties, making it a candidate for further studies in materials science and drug development. Safety and handling precautions should be observed due to the presence of chlorine and potential reactivity associated with boron compounds.
Formula:C18H20BClO2S
InChI:InChI=1S/C18H20BClO2S/c1-17(2)18(3,4)22-19(21-17)13-10-14(20)12-16(11-13)23-15-8-6-5-7-9-15/h5-12H,1-4H3
InChI key:InChIKey=JJYTWJKVTZMXCD-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(SC3=CC=CC=C3)=CC(Cl)=C2
Synonyms:
  • 2-[3-Chloro-5-(phenylthio)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 2-[3-chloro-5-(phenylthio)phenyl]-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.