
CAS 942070-08-8
:2-[2-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thienyl]dihydro-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
The chemical substance known as "2-[2-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thienyl]dihydro-4,4,5,5-tetramethyl-1,3,2-dioxaborolane" with CAS number 942070-08-8 is characterized by its complex molecular structure, which includes a thienyl group and multiple dioxaborolane units. This compound features a bromine atom, which contributes to its reactivity and potential applications in organic synthesis, particularly in cross-coupling reactions. The presence of the dioxaborolane moiety suggests that it may serve as a boron-containing reagent, which is valuable in various chemical transformations. The tetramethyl groups enhance its steric bulk, potentially influencing its solubility and reactivity. Additionally, the compound's unique structure may impart specific electronic properties, making it of interest in materials science and medicinal chemistry. Overall, this substance exemplifies the intricate design often found in organoboron compounds, which are pivotal in modern synthetic methodologies.
Formula:C16H25B2BrO4S
InChI:InChI=1S/C16H25B2BrO4S/c1-13(2)14(3,4)21-17(20-13)10-9-11(24-12(10)19)18-22-15(5,6)16(7,8)23-18/h9H,1-8H3
InChI key:InChIKey=FOTHZOWQAXHYDC-UHFFFAOYSA-N
SMILES:BrC1=C(B2OC(C)(C)C(C)(C)O2)C=C(S1)B3OC(C)(C)C(C)(C)O3
Synonyms:- 2-[2-Bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thienyl]dihydro-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-[2-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-thienyl]dihydro-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2'(5-BROMOTHIOPHENE-2,4-DIYL)BIS(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE)
CAS:Formula:C16H25B2BrO4SMolecular weight:414.9583
