
CAS 942070-12-4
:2-(2-Bromo-3-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-(2-Bromo-3-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structure, which includes a dioxaborolane ring and a thienyl group. The presence of the bromine atom introduces a halogen functionality that can participate in various chemical reactions, such as nucleophilic substitutions or cross-coupling reactions. The tetramethyl substituents on the dioxaborolane ring enhance its stability and solubility in organic solvents, making it a useful intermediate in organic synthesis. This compound is often utilized in the field of medicinal chemistry and materials science, particularly in the development of boron-containing compounds for applications in drug discovery and organic electronics. Its reactivity and functionalization potential make it a valuable building block for synthesizing more complex molecules. Additionally, the thienyl moiety can impart specific electronic properties, which may be advantageous in various applications, including agrochemicals and pharmaceuticals.
Formula:C10H14BBrO2S
InChI:InChI=1S/C10H14BBrO2S/c1-9(2)10(3,4)14-11(13-9)7-5-6-15-8(7)12/h5-6H,1-4H3
InChI key:InChIKey=YEEODTNVPIHAEJ-UHFFFAOYSA-N
SMILES:BrC1=C(B2OC(C)(C)C(C)(C)O2)C=CS1
Synonyms:- 2-(2-Bromothiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 2-(2-Bromo-3-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-(2-bromo-3-thienyl)-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-Bromo-3-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C10H14BBrO2SMolecular weight:288.9970
